N-(Cyclopropylmethyl)mephedrone
2-[(Cyclopropylmethyl)(methyl)amino]-1-(4-methylphenyl)propan-1-one
 1951 C15H21NO 231.333
 InChI=1S/C15H21NO/c1-11-4-8-14(9-5-11)15(17)12(2)16(3)10-13-6-7-13/h4-5,8-9,12-13H,6-7,10H2,1-3H3
 RSJIUAYVBHDSGQ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(C(=O)c1ccc(cc1)C)N(CC1CC1)C