4-Methallyloxy-3,5-dimethoxy-β-methyl-β-nitrostyrene
1,3-Dimethoxy-2-[(2-methylprop-2-en-1-yl)oxy]-5-[(1E)-2-nitroprop-1-en-1-yl]benzene
 1946  C15H19NO5  293.315
 InChI=1S/C15H19NO5/c1-10(2)9-21-15-13(19-4)7-12(8-14(15)20-5)6-11(3)16(17)18/h6-8H,1,9H2,2-5H3/b11-6+
 NYTGLCQUFZCMCM-IZZDOVSWSA-N This stereoisomer Any stereoisomer
 COc1cc(cc(c1OCC(=C)C)OC)/C=C(/N(=O)=O)\C