4-AlO-3,5-DMBAL
3,5-Dimethoxy-4-[(prop-2-en-1-yl)oxy]benzaldehyde
 1930  C12H14O4  222.237
 InChI=1S/C12H14O4/c1-4-5-16-12-10(14-2)6-9(8-13)7-11(12)15-3/h4,6-8H,1,5H2,2-3H3
 KZQUZEMCCPKQCU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 C=CCOc1c(OC)cc(cc1OC)C=O