2,5-DMAI
4,7-Dimethoxy-2,3-dihydro-1H-inden-2-amine
 193 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-13-10-3-4-11(14-2)9-6-7(12)5-8(9)10/h3-4,7H,5-6,12H2,1-2H3
 MOUCINMECNAGTR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1ccc(c2c1CC(C2)N)OC