1-(2,5-Dimethoxy-4-methylphenyl)-N-hydroxy-2-aminobutane
1-(2,5-Dimethoxy-4-methylphenyl)-N-hydroxybutan-2-amine
 189 C13H21NO3 239.311
 InChI=1S/C13H21NO3/c1-5-11(14-15)7-10-8-12(16-3)9(2)6-13(10)17-4/h6,8,11,14-15H,5,7H2,1-4H3
 IODVUUDTFABAJR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(Cc1cc(OC)c(cc1OC)C)NO