2-Amino-1-(4-ethyl-2,5-dimethoxyphenyl)ethan-1-ol
 1760 C12H19NO3 225.284
 InChI=1S/C12H19NO3/c1-4-8-5-12(16-3)9(10(14)7-13)6-11(8)15-2/h5-6,10,14H,4,7,13H2,1-3H3
 QFOGKMIVOSUPQZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC(c1cc(OC)c(cc1OC)CC)O