(4-Ethyl-2,5-dimethoxyphenyl)(hydroxy)acetonitrile
 1758 C12H15NO3 221.252
 InChI=1S/C12H15NO3/c1-4-8-5-12(16-3)9(10(14)7-13)6-11(8)15-2/h5-6,10,14H,4H2,1-3H3
 ZPUVWAMKRBCGPD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 N#CC(c1cc(OC)c(cc1OC)CC)O