N-Methyl-acetyl-norfentanyl
N-(1-Methylpiperidin-4-yl)-N-phenylacetamide
 1681 C14H20N2O 232.321
 Fentanyl
 InChI=1S/C14H20N2O/c1-12(17)16(13-6-4-3-5-7-13)14-8-10-15(2)11-9-14/h3-7,14H,8-11H2,1-2H3
 JRDQNWRUEQCCAW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN1CCC(CC1)N(c1ccccc1)C(=O)C