N,N-Me-4-Br-PEA
2-(4-Bromophenyl)-N,N-dimethylethan-1-amine
 1580  C10H14BrN  228.129
 InChI=1S/C10H14BrN/c1-12(2)8-7-9-3-5-10(11)6-4-9/h3-6H,7-8H2,1-2H3
 RWCMKTSVOYKLQY-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1ccc(cc1)Br)C