N,N-Me-3-Br-PEA
2-(3-Bromophenyl)-N,N-dimethylethan-1-amine
 1578  C10H14BrN  228.129
 InChI=1S/C10H14BrN/c1-12(2)7-6-9-4-3-5-10(11)8-9/h3-5,8H,6-7H2,1-2H3
 GYUROIYIUNTCGL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1cccc(c1)Br)C