N,N-Me-4-Cl-PEA
2-(4-Chlorophenyl)-N,N-dimethylethan-1-amine
 1574  C10H14ClN  183.678
 InChI=1S/C10H14ClN/c1-12(2)8-7-9-3-5-10(11)6-4-9/h3-6H,7-8H2,1-2H3
 RKLSNRMANRTWPZ-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1ccc(cc1)Cl)C