N,N-Me-3-Cl-PEA
2-(3-Chlorophenyl)-N,N-dimethylethan-1-amine
 1572  C10H14ClN  183.678
 InChI=1S/C10H14ClN/c1-12(2)7-6-9-4-3-5-10(11)8-9/h3-5,8H,6-7H2,1-2H3
 BKRCVTMYFIKQPN-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1cccc(c1)Cl)C