N,N-Me-2-Cl-PEA
2-(2-Chlorophenyl)-N,N-dimethylethan-1-amine
 1570  C10H14ClN  183.678
 InChI=1S/C10H14ClN/c1-12(2)8-7-9-5-3-4-6-10(9)11/h3-6H,7-8H2,1-2H3
 NCJUMHFWIRWDBF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CN(CCc1ccccc1Cl)C