PCPEA
1-(1-Phenylcyclopropyl)methanamine
 1560 C10H13N 147.217
 InChI=1S/C10H13N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-8,11H2
 FUEMGCALFIHXAS-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCC1(CC1)c1ccccc1