2,6-Cl-PEA
2-(2,6-Dichlorophenyl)ethan-1-amine
 1554 C8H9Cl2N 190.07
 InChI=1S/C8H9Cl2N/c9-7-2-1-3-8(10)6(7)4-5-11/h1-3H,4-5,11H2
 ACIMQXSSGMWVKG-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1c(Cl)cccc1Cl