4,3,5-DOPR
1-(3,5-Dimethoxy-4-propylphenyl)propan-2-amine
 1526 C14H23NO2 237.338
 InChI=1S/C14H23NO2/c1-5-6-12-13(16-3)8-11(7-10(2)15)9-14(12)17-4/h8-10H,5-7,15H2,1-4H3
 BCHNSROYYVUCKR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCc1c(OC)cc(cc1OC)CC(N)C