POMA
1-(3-Methoxy-4-propoxyphenyl)propan-2-amine
 1505 C13H21NO2 223.311
 InChI=1S/C13H21NO2/c1-4-7-16-12-6-5-11(8-10(2)14)9-13(12)15-3/h5-6,9-10H,4,7-8,14H2,1-3H3
 NUKLCVRWHABVOH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCOc1ccc(cc1OC)CC(N)C