4-BzO-3-MeO-5-MePEA
1-[4-(Benzyloxy)-3-methoxy-5-methylphenyl]propan-2-amine
 1464  C18H23NO2  285.381
 InChI=1S/C18H23NO2/c1-13-9-16(10-14(2)19)11-17(20-3)18(13)21-12-15-7-5-4-6-8-15/h4-9,11,14H,10,12,19H2,1-3H3
 XMEIAUSAEXNFNT-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(N)C)cc(c1OCc1ccccc1)C