2,5-HO-4-MePEA
2-(2-Aminoethyl)-5-methylbenzene-1,4-diol
 1456 C9H13NO2 167.205
 InChI=1S/C9H13NO2/c1-6-4-9(12)7(2-3-10)5-8(6)11/h4-5,11-12H,2-3,10H2,1H3
 JXAPACXEBBSTBW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(O)c(cc1O)C