8-Methoxy-N-methyl-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1445 C15H23NO 233.349
 InChI=1S/C15H23NO/c1-4-10-16(2)13-9-8-12-6-5-7-15(17-3)14(12)11-13/h5-7,13H,4,8-11H2,1-3H3
 WRBAAJSAYGTSMA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCN(C1CCc2c(C1)c(OC)ccc2)C