8-Methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1444 C14H21NO 219.323
 InChI=1S/C14H21NO/c1-3-9-15-12-8-7-11-5-4-6-14(16-2)13(11)10-12/h4-6,12,15H,3,7-10H2,1-2H3
 MLSPZCYBIFMZQH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCNC1CCc2c(C1)c(OC)ccc2