O-2525
1-(4-Methylphenyl)-3-(pyrrolidin-1-yl)pentan-1-one
 1422  C16H23NO  245.36
 InChI=1S/C16H23NO/c1-3-15(17-10-4-5-11-17)12-16(18)14-8-6-13(2)7-9-14/h6-9,15H,3-5,10-12H2,1-2H3
 CCCKABNBMAAFTD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(N1CCCC1)CC(=O)c1ccc(cc1)C