O-2480
1-(3-Methylphenyl)-2-(pyrrolidin-1-yl)pentan-1-one
 1414  C16H23NO  245.36
 InChI=1S/C16H23NO/c1-3-7-15(17-10-4-5-11-17)16(18)14-9-6-8-13(2)12-14/h6,8-9,12,15H,3-5,7,10-11H2,1-2H3
 HHSYAWUBPBEDMP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1cccc(c1)C)N1CCCC1