O-2479
1-(2-Methylphenyl)-2-(pyrrolidin-1-yl)pentan-1-one
 1413  C16H23NO  245.36
 InChI=1S/C16H23NO/c1-3-8-15(17-11-6-7-12-17)16(18)14-10-5-4-9-13(14)2/h4-5,9-10,15H,3,6-8,11-12H2,1-2H3
 VVIVTDYOMWHKAE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccccc1C)N1CCCC1