O-2537
1-[4-(Prop-1-yn-1-yl)phenyl]-2-(pyrrolidin-1-yl)pentan-1-one
 1412  C18H23NO  269.381
 InChI=1S/C18H23NO/c1-3-7-15-9-11-16(12-10-15)18(20)17(8-4-2)19-13-5-6-14-19/h9-12,17H,4-6,8,13-14H2,1-2H3
 FCINLQHPPAWABH-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc(cc1)C#CC)N1CCCC1