O-2577
1-[4-(Hydroxymethyl)phenyl]-2-(pyrrolidin-1-yl)pentan-1-one
 1406 C16H23NO2 261.359
 InChI=1S/C16H23NO2/c1-2-5-15(17-10-3-4-11-17)16(19)14-8-6-13(12-18)7-9-14/h6-9,15,18H,2-5,10-12H2,1H3
 FDCLNKXJEZCPEW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCC(C(=O)c1ccc(cc1)CO)N1CCCC1