MXiP
2-(3-Methoxyphenyl)-2-[(propan-2-yl)amino]cyclohexan-1-one
 14059  C16H23NO2  261.359
 Arylcycloalkylamine
 InChI=1S/C16H23NO2/c1-12(2)17-16(10-5-4-9-15(16)18)13-7-6-8-14(11-13)19-3/h6-8,11-12,17H,4-5,9-10H2,1-3H3
 FTQIVDGNGXPEKP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cccc(c1)C1(CCCCC1=O)NC(C)C