2-(2,4,6-Trimethoxyphenyl)cyclopropan-1-amine
 13735  C12H17NO3  223.268
 InChI=1S/C12H17NO3/c1-14-7-4-10(15-2)12(8-6-9(8)13)11(5-7)16-3/h4-5,8-9H,6,13H2,1-3H3
 PSZZKLQZWAAUIU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC)cc(c1C1CC1N)OC