4-cPe3enO-3,5-DMPEA
2-{4-[(Cyclopent-3-en-1-yl)oxy]-3,5-dimethoxyphenyl}ethan-1-amine
 13703  C15H21NO3  263.332
 InChI=1S/C15H21NO3/c1-17-13-9-11(7-8-16)10-14(18-2)15(13)19-12-5-3-4-6-12/h3-4,9-10,12H,5-8,16H2,1-2H3
 GDAJWTSYHHQLKP-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 NCCc1cc(OC)c(c(c1)OC)OC1CC=CC1