N,N-Bis(2-phenylethyl)butan-1-amine
 1345  C20H27N  281.435
 InChI=1S/C20H27N/c1-2-3-16-21(17-14-19-10-6-4-7-11-19)18-15-20-12-8-5-9-13-20/h4-13H,2-3,14-18H2,1H3
 AWWNNIPXRFZEHF-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCCCN(CCc1ccccc1)CCc1ccccc1