1-Phenyl-2-propanol
1-Phenylpropan-2-ol
 1339 C9H12O 136.191
 InChI=1S/C9H12O/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8,10H,7H2,1H3
 WYTRYIUQUDTGSX-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(Cc1ccccc1)O