ADB-5Br-BINACA
N-[(2S)-1-Amino-3,3-dimethyl-1-oxobutan-2-yl]-5-bromo-1-butyl-1H-indazole-3-carboxamide
 13333  C18H25BrN4O2  409.321
 Cannabinoid
 InChI=1S/C18H25BrN4O2/c1-5-6-9-23-13-8-7-11(19)10-12(13)14(22-23)17(25)21-15(16(20)24)18(2,3)4/h7-8,10,15H,5-6,9H2,1-4H3,(H2,20,24)(H,21,25)/t15-/m1/s1
 DIOILIVJIIJFPO-OAHLLOKOSA-N This stereoisomer Any stereoisomer
 CCCCn1nc(c2c1ccc(c2)Br)C(=O)N[C@@H](C(C)(C)C)C(=O)N