N-Methyl-2-aminotetralin
N-Methyl-1,2,3,4-tetrahydronaphthalen-2-amine
 1317  C11H15N  161.244
 InChI=1S/C11H15N/c1-12-11-7-6-9-4-2-3-5-10(9)8-11/h2-5,11-12H,6-8H2,1H3
 NZARMFRLPAOETR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNC1CCc2c(C1)cccc2