2C-E-2ETO-3PIP
3-(2-Ethoxy-4-ethyl-5-methoxyphenyl)piperidine
 13037  C16H25NO2  263.375
 InChI=1S/C16H25NO2/c1-4-12-9-16(19-5-2)14(10-15(12)18-3)13-7-6-8-17-11-13/h9-10,13,17H,4-8,11H2,1-3H3
 CBBFREYVJSSVIL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCOc1cc(CC)c(cc1C1CCCNC1)OC