4-(Butan-2-yl)-2,5-dimethoxybenzaldehyde
 12846  C13H18O3  222.28
 InChI=1S/C13H18O3/c1-5-9(2)11-7-12(15-3)10(8-14)6-13(11)16-4/h6-9H,5H2,1-4H3
 WHITVDMDFRMBIU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCC(c1cc(OC)c(cc1OC)C=O)C