2,5-Dimethyl-β-methyl-β-nitrostyrene
1,4-Dimethyl-2-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12843  C11H13NO2  191.226
 InChI=1S/C11H13NO2/c1-8-4-5-9(2)11(6-8)7-10(3)12(13)14/h4-7H,1-3H3/b10-7+
 CQEQATGRIJNIQI-JXMROGBWSA-N This stereoisomer Any stereoisomer
 Cc1ccc(c(c1)/C=C(/N(=O)=O)\C)C