N,N-Diethyl-2-[2-(4-methoxyphenyl)-1H-indol-3-yl]ethan-1-amine
 12575  C21H26N2O  322.444
 InChI=1S/C21H26N2O/c1-4-23(5-2)15-14-19-18-8-6-7-9-20(18)22-21(19)16-10-12-17(24-3)13-11-16/h6-13,22H,4-5,14-15H2,1-3H3
 ZYVLCNMRBDXGCR-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCc1c([nH]c2c1cccc2)c1ccc(cc1)OC)CC