1-(4-Bromo-2-methylphenoxy)propan-2-amine
 12420 C10H14BrNO 244.128
 InChI=1S/C10H14BrNO/c1-7-5-9(11)3-4-10(7)13-6-8(2)12/h3-5,8H,6,12H2,1-2H3
 WZMRNJWGIFHPEW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(COc1ccc(cc1C)Br)N