1-(2-Methylphenoxy)propan-2-amine
 12416 C10H15NO 165.232
 InChI=1S/C10H15NO/c1-8-5-3-4-6-10(8)12-7-9(2)11/h3-6,9H,7,11H2,1-2H3
 AUWZEXMVEMHCAL-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CC(COc1ccccc1C)N