3,4-Diethoxy-β-methyl-β-nitrostyrene
1,2-Diethoxy-4-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12360  C13H17NO4  251.278
 InChI=1S/C13H17NO4/c1-4-17-12-7-6-11(8-10(3)14(15)16)9-13(12)18-5-2/h6-9H,4-5H2,1-3H3/b10-8+
 JMPFGBSWLWZTIG-CSKARUKUSA-N This stereoisomer Any stereoisomer
 CCOc1cc(ccc1OCC)/C=C(/N(=O)=O)\C