4-Methoxy-3-propoxy-β-methyl-β-nitrostyrene
1-Methoxy-4-[(1E)-2-nitroprop-1-en-1-yl]-2-propoxybenzene
 12359  C13H17NO4  251.278
 InChI=1S/C13H17NO4/c1-4-7-18-13-9-11(5-6-12(13)17-3)8-10(2)14(15)16/h5-6,8-9H,4,7H2,1-3H3/b10-8+
 LSLRWVCOXPNLLF-CSKARUKUSA-N This stereoisomer Any stereoisomer
 CCCOc1cc(ccc1OC)/C=C(/N(=O)=O)\C