10.1016j.bmcl.2011.02.082 #6c
(2,3-Dichlorophenyl){1-[(4,4-difluoropiperidin-1-yl)methyl]imidazo[1,5-a]pyridin-3-yl}methanone
 12300  C20H17Cl2F2N3O  424.271
 Cannabinoid
 InChI=1S/C20H17Cl2F2N3O/c21-14-5-3-4-13(17(14)22)18(28)19-25-15(16-6-1-2-9-27(16)19)12-26-10-7-20(23,24)8-11-26/h1-6,9H,7-8,10-12H2
 SCAJGFRGQJAWBD-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 O=C(c1nc(c2n1cccc2)CN1CCC(CC1)(F)F)c1cccc(c1Cl)Cl