iso-MDMA
3-(2H-1,3-Benzodioxol-5-yl)-N-methylpropan-1-amine
 12268 C11H15NO2 193.242
 InChI=1S/C11H15NO2/c1-12-6-2-3-9-4-5-10-11(7-9)14-8-13-10/h4-5,7,12H,2-3,6,8H2,1H3
 ZPXKZQIHSNWFNW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CNCCCc1ccc2c(c1)OCO2