4-(Difluoromethoxy)-2,6-dimethoxy-β-methyl-β-nitrostyrene
5-(Difluoromethoxy)-1,3-dimethoxy-2-[(1E)-2-nitroprop-1-en-1-yl]benzene
 12249  C12H13F2NO5  289.232
 InChI=1S/C12H13F2NO5/c1-7(15(16)17)4-9-10(18-2)5-8(20-12(13)14)6-11(9)19-3/h4-6,12H,1-3H3/b7-4+
 OBTJJYIAVUBWRE-QPJJXVBHSA-N This stereoisomer Any stereoisomer
 COc1cc(OC(F)F)cc(c1/C=C(/N(=O)=O)\C)OC