4-DFMeO-2,6-DMBAL
4-(Difluoromethoxy)-2,6-dimethoxybenzaldehyde
 12247  C10H10F2O4  232.181
 InChI=1S/C10H10F2O4/c1-14-8-3-6(16-10(11)12)4-9(15-2)7(8)5-13/h3-5,10H,1-2H3
 SUJOFZKEXYVOCU-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(OC(F)F)cc(c1C=O)OC