2,5-Dimethoxy-4-(2,2,2-trifluoroethyl)-β-methyl-β-nitrostyrene
1,4-Dimethoxy-2-[(1E)-2-nitroprop-1-en-1-yl]-5-(2,2,2-trifluoroethyl)benzene
 12236  C13H14F3NO4  305.25
 InChI=1S/C13H14F3NO4/c1-8(17(18)19)4-9-5-12(21-3)10(6-11(9)20-2)7-13(14,15)16/h4-6H,7H2,1-3H3/b8-4+
 CTSFVEXJTGMEKO-XBXARRHUSA-N This stereoisomer Any stereoisomer
 COc1cc(CC(F)(F)F)c(cc1/C=C(/N(=O)=O)\C)OC