4-(2,2,2-TF-Et)-2,5-DMBAL
2,5-Dimethoxy-4-(2,2,2-trifluoroethyl)benzaldehyde
 12234  C11H11F3O3  248.198
 InChI=1S/C11H11F3O3/c1-16-9-4-8(6-15)10(17-2)3-7(9)5-11(12,13)14/h3-4,6H,5H2,1-2H3
 NXEZWWCQNIOZSA-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C=O)c(cc1CC(F)(F)F)OC