4-Isopropyl-2,5-dimethoxy-β-methyl-β-nitrostyrene
1,4-Dimethoxy-2-[(1E)-2-nitroprop-1-en-1-yl]-5-(propan-2-yl)benzene
 12226  C14H19NO4  265.305
 InChI=1S/C14H19NO4/c1-9(2)12-8-13(18-4)11(7-14(12)19-5)6-10(3)15(16)17/h6-9H,1-5H3/b10-6+
 HRKNPTWNKRUAOY-UXBLZVDNSA-N This stereoisomer Any stereoisomer
 COc1cc(C(C)C)c(cc1/C=C(/N(=O)=O)\C)OC