4-iPr-2,5-DMBAL
2,5-Dimethoxy-4-(propan-2-yl)benzaldehyde
 12224  C12H16O3  208.254
 InChI=1S/C12H16O3/c1-8(2)10-6-11(14-3)9(7-13)5-12(10)15-4/h5-8H,1-4H3
 RVVOAJNVARQGQW-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 COc1cc(C(C)C)c(cc1C=O)OC