4-[3-(Diethylamino)propoxy]benzonitrile
 12136 C14H20N2O 232.321
 InChI=1S/C14H20N2O/c1-3-16(4-2)10-5-11-17-14-8-6-13(12-15)7-9-14/h6-9H,3-5,10-11H2,1-2H3
 VYKPSPFZDJGTOE-UHFFFAOYSA-N This stereoisomer Any stereoisomer
 CCN(CCCOc1ccc(cc1)C#N)CC